C25H20ClN3O4S2 — CID 2204642
methyl 3-chloro-6-[[(2-hydroxy-2,2-diphenylacetyl)amino]carbamothioylamino]-1-benzothiophene-2-carboxylate (PubChem CID 2204642) has the molecular formula C25H20ClN3O4S2 and a molecular weight of 526.04 g/mol. Its IUPAC name is methyl 3-chloro-6-[[(2-hydroxy-2,2-diphenylacetyl)amino]carbamothioylamino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-chloro-6-[[(2-hydroxy-2,2-diphenylacetyl)amino]carbamothioylamino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 2204642 |
| Molecular Formula | C25H20ClN3O4S2 |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.06 |
| IUPAC Name | methyl 3-chloro-6-[[(2-hydroxy-2,2-diphenylacetyl)amino]carbamothioylamino]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2cc(NC(=S)NNC(=O)C(O)(c3ccccc3)c3ccccc3)ccc2c1Cl |
| InChI | InChI=1S/C25H20ClN3O4S2/c1-33-22(30)21-20(26)18-13-12-17(14-19(18)35-21)27-24(34)29-28-23(31)25(32,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-14,32H,1H3,(H,28,31)(H2,27,29,34) |
| InChIKey | OHAMWJJPNTZMBB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|