C20H18ClN3O3S2 — CID 19649193
methyl 6-[[4-[acetyl(methyl)amino]phenyl]carbamothioylamino]-3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 19649193) has the molecular formula C20H18ClN3O3S2 and a molecular weight of 447.97 g/mol. Its IUPAC name is methyl 6-[[4-[acetyl(methyl)amino]phenyl]carbamothioylamino]-3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 6-[[4-[acetyl(methyl)amino]phenyl]carbamothioylamino]-3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19649193 |
| Molecular Formula | C20H18ClN3O3S2 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | methyl 6-[[4-[acetyl(methyl)amino]phenyl]carbamothioylamino]-3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2cc(NC(=S)Nc3ccc(N(C)C(C)=O)cc3)ccc2c1Cl |
| InChI | InChI=1S/C20H18ClN3O3S2/c1-11(25)24(2)14-7-4-12(5-8-14)22-20(28)23-13-6-9-15-16(10-13)29-18(17(15)21)19(26)27-3/h4-10H,1-3H3,(H2,22,23,28) |
| InChIKey | POVDEJKVZYHRKM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|