C19H25ClN2O2S2 — CID 19652267
methyl 3-chloro-6-(2,4,4-trimethylpentan-2-ylcarbamothioylamino)-1-benzothiophene-2-carboxylate (PubChem CID 19652267) has the molecular formula C19H25ClN2O2S2 and a molecular weight of 413.01 g/mol. Its IUPAC name is methyl 3-chloro-6-(2,4,4-trimethylpentan-2-ylcarbamothioylamino)-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-chloro-6-(2,4,4-trimethylpentan-2-ylcarbamothioylamino)-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19652267 |
| Molecular Formula | C19H25ClN2O2S2 |
| Molecular Weight | 413.01 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | methyl 3-chloro-6-(2,4,4-trimethylpentan-2-ylcarbamothioylamino)-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2cc(NC(=S)NC(C)(C)CC(C)(C)C)ccc2c1Cl |
| InChI | InChI=1S/C19H25ClN2O2S2/c1-18(2,3)10-19(4,5)22-17(25)21-11-7-8-12-13(9-11)26-15(14(12)20)16(23)24-6/h7-9H,10H2,1-6H3,(H2,21,22,25) |
| InChIKey | WLUPEWZBPZXQGR-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.01 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|