C20H19ClN2O5S2 — CID 19678023
methyl 3-chloro-6-[(3,4,5-trimethoxyphenyl)carbamothioylamino]-1-benzothiophene-2-carboxylate (PubChem CID 19678023) has the molecular formula C20H19ClN2O5S2 and a molecular weight of 466.97 g/mol. Its IUPAC name is methyl 3-chloro-6-[(3,4,5-trimethoxyphenyl)carbamothioylamino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-chloro-6-[(3,4,5-trimethoxyphenyl)carbamothioylamino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19678023 |
| Molecular Formula | C20H19ClN2O5S2 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.04 |
| IUPAC Name | methyl 3-chloro-6-[(3,4,5-trimethoxyphenyl)carbamothioylamino]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2cc(NC(=S)Nc3cc(OC)c(OC)c(OC)c3)ccc2c1Cl |
| InChI | InChI=1S/C20H19ClN2O5S2/c1-25-13-7-11(8-14(26-2)17(13)27-3)23-20(29)22-10-5-6-12-15(9-10)30-18(16(12)21)19(24)28-4/h5-9H,1-4H3,(H2,22,23,29) |
| InChIKey | CUTLAULHZBLSAU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|