C21H23ClN2O2S2 — CID 19651547
methyl 6-(1-adamantylcarbamothioylamino)-3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 19651547) has the molecular formula C21H23ClN2O2S2 and a molecular weight of 435.01 g/mol. Its IUPAC name is methyl 6-(1-adamantylcarbamothioylamino)-3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 6-(1-adamantylcarbamothioylamino)-3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19651547 |
| Molecular Formula | C21H23ClN2O2S2 |
| Molecular Weight | 435.01 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | methyl 6-(1-adamantylcarbamothioylamino)-3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2cc(NC(=S)NC34CC5CC(CC(C5)C3)C4)ccc2c1Cl |
| InChI | InChI=1S/C21H23ClN2O2S2/c1-26-19(25)18-17(22)15-3-2-14(7-16(15)28-18)23-20(27)24-21-8-11-4-12(9-21)6-13(5-11)10-21/h2-3,7,11-13H,4-6,8-10H2,1H3,(H2,23,24,27) |
| InChIKey | CDZYHBFJFLNODQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.01 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|