C17H20ClN3O2S2 — CID 17270563
methyl 3-chloro-6-[(4-ethylpiperazine-1-carbothioyl)amino]-1-benzothiophene-2-carboxylate (PubChem CID 17270563) has the molecular formula C17H20ClN3O2S2 and a molecular weight of 397.95 g/mol. Its IUPAC name is methyl 3-chloro-6-[(4-ethylpiperazine-1-carbothioyl)amino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-chloro-6-[(4-ethylpiperazine-1-carbothioyl)amino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 17270563 |
| Molecular Formula | C17H20ClN3O2S2 |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | methyl 3-chloro-6-[(4-ethylpiperazine-1-carbothioyl)amino]-1-benzothiophene-2-carboxylate |
| SMILES | CCN1CCN(C(=S)Nc2ccc3c(Cl)c(C(=O)OC)sc3c2)CC1 |
| InChI | InChI=1S/C17H20ClN3O2S2/c1-3-20-6-8-21(9-7-20)17(24)19-11-4-5-12-13(10-11)25-15(14(12)18)16(22)23-2/h4-5,10H,3,6-9H2,1-2H3,(H,19,24) |
| InChIKey | GOIZFQZWMONQRO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|