C15H15ClN2O3S2 — CID 17371452
methyl 3-chloro-6-(morpholine-4-carbothioylamino)-1-benzothiophene-2-carboxylate (PubChem CID 17371452) has the molecular formula C15H15ClN2O3S2 and a molecular weight of 370.88 g/mol. Its IUPAC name is methyl 3-chloro-6-(morpholine-4-carbothioylamino)-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-chloro-6-(morpholine-4-carbothioylamino)-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 17371452 |
| Molecular Formula | C15H15ClN2O3S2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | methyl 3-chloro-6-(morpholine-4-carbothioylamino)-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2cc(NC(=S)N3CCOCC3)ccc2c1Cl |
| InChI | InChI=1S/C15H15ClN2O3S2/c1-20-14(19)13-12(16)10-3-2-9(8-11(10)23-13)17-15(22)18-4-6-21-7-5-18/h2-3,8H,4-7H2,1H3,(H,17,22) |
| InChIKey | JZEJZGQFVBMNOE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|