C19H17ClN2O4S2 — CID 19677412
methyl 3-chloro-6-[(3,4-dimethoxyphenyl)carbamothioylamino]-1-benzothiophene-2-carboxylate (PubChem CID 19677412) has the molecular formula C19H17ClN2O4S2 and a molecular weight of 436.94 g/mol. Its IUPAC name is methyl 3-chloro-6-[(3,4-dimethoxyphenyl)carbamothioylamino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-chloro-6-[(3,4-dimethoxyphenyl)carbamothioylamino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19677412 |
| Molecular Formula | C19H17ClN2O4S2 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | methyl 3-chloro-6-[(3,4-dimethoxyphenyl)carbamothioylamino]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2cc(NC(=S)Nc3ccc(OC)c(OC)c3)ccc2c1Cl |
| InChI | InChI=1S/C19H17ClN2O4S2/c1-24-13-7-5-10(8-14(13)25-2)21-19(27)22-11-4-6-12-15(9-11)28-17(16(12)20)18(23)26-3/h4-9H,1-3H3,(H2,21,22,27) |
| InChIKey | LPUNSBXYKMZDKQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|