C23H16Cl2N2O2S3 — CID 19677497
methyl 3-chloro-6-[[2-(4-chlorophenyl)sulfanylphenyl]carbamothioylamino]-1-benzothiophene-2-carboxylate (PubChem CID 19677497) has the molecular formula C23H16Cl2N2O2S3 and a molecular weight of 519.50 g/mol. Its IUPAC name is methyl 3-chloro-6-[[2-(4-chlorophenyl)sulfanylphenyl]carbamothioylamino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-chloro-6-[[2-(4-chlorophenyl)sulfanylphenyl]carbamothioylamino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19677497 |
| Molecular Formula | C23H16Cl2N2O2S3 |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 517.98 |
| IUPAC Name | methyl 3-chloro-6-[[2-(4-chlorophenyl)sulfanylphenyl]carbamothioylamino]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2cc(NC(=S)Nc3ccccc3Sc3ccc(Cl)cc3)ccc2c1Cl |
| InChI | InChI=1S/C23H16Cl2N2O2S3/c1-29-22(28)21-20(25)16-11-8-14(12-19(16)32-21)26-23(30)27-17-4-2-3-5-18(17)31-15-9-6-13(24)7-10-15/h2-12H,1H3,(H2,26,27,30) |
| InChIKey | NGPBCTIHZOLDFC-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|