C20H16Cl2N2S2 — CID 19677469
1-(3-chloro-4-methylphenyl)-3-[2-(4-chlorophenyl)sulfanylphenyl]thiourea (PubChem CID 19677469) has the molecular formula C20H16Cl2N2S2 and a molecular weight of 419.40 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[2-(4-chlorophenyl)sulfanylphenyl]thiourea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[2-(4-chlorophenyl)sulfanylphenyl]thiourea |
|---|---|
| PubChem CID | 19677469 |
| Molecular Formula | C20H16Cl2N2S2 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[2-(4-chlorophenyl)sulfanylphenyl]thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccccc2Sc2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C20H16Cl2N2S2/c1-13-6-9-15(12-17(13)22)23-20(25)24-18-4-2-3-5-19(18)26-16-10-7-14(21)8-11-16/h2-12H,1H3,(H2,23,24,25) |
| InChIKey | LOICRXGYDBFICF-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|