C21H19ClN2S2 — CID 19677466
1-[2-(4-chlorophenyl)sulfanylphenyl]-3-(3,5-dimethylphenyl)thiourea (PubChem CID 19677466) has the molecular formula C21H19ClN2S2 and a molecular weight of 398.98 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylphenyl]-3-(3,5-dimethylphenyl)thiourea.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylphenyl]-3-(3,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 19677466 |
| Molecular Formula | C21H19ClN2S2 |
| Molecular Weight | 398.98 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylphenyl]-3-(3,5-dimethylphenyl)thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)Nc2ccccc2Sc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C21H19ClN2S2/c1-14-11-15(2)13-17(12-14)23-21(25)24-19-5-3-4-6-20(19)26-18-9-7-16(22)8-10-18/h3-13H,1-2H3,(H2,23,24,25) |
| InChIKey | RERJYJWTOZWOEK-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.98 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|