C20H14Cl2N2O2S — CID 108515224
N'-(3,5-dichlorophenyl)-N-(2-phenylsulfanylphenyl)oxamide (PubChem CID 108515224) has the molecular formula C20H14Cl2N2O2S and a molecular weight of 417.32 g/mol. Its IUPAC name is N'-(3,5-dichlorophenyl)-N-(2-phenylsulfanylphenyl)oxamide.
| Compound Name | N'-(3,5-dichlorophenyl)-N-(2-phenylsulfanylphenyl)oxamide |
|---|---|
| PubChem CID | 108515224 |
| Molecular Formula | C20H14Cl2N2O2S |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | N'-(3,5-dichlorophenyl)-N-(2-phenylsulfanylphenyl)oxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)C(=O)Nc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C20H14Cl2N2O2S/c21-13-10-14(22)12-15(11-13)23-19(25)20(26)24-17-8-4-5-9-18(17)27-16-6-2-1-3-7-16/h1-12H,(H,23,25)(H,24,26) |
| InChIKey | QJKZEHYNUJFZKE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|