C22H20N2O2S — CID 108515146
N-(3,4-dimethylphenyl)-N'-(2-phenylsulfanylphenyl)oxamide (PubChem CID 108515146) has the molecular formula C22H20N2O2S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-N'-(2-phenylsulfanylphenyl)oxamide.
| Compound Name | N-(3,4-dimethylphenyl)-N'-(2-phenylsulfanylphenyl)oxamide |
|---|---|
| PubChem CID | 108515146 |
| Molecular Formula | C22H20N2O2S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-(3,4-dimethylphenyl)-N'-(2-phenylsulfanylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)Nc2ccccc2Sc2ccccc2)cc1C |
| InChI | InChI=1S/C22H20N2O2S/c1-15-12-13-17(14-16(15)2)23-21(25)22(26)24-19-10-6-7-11-20(19)27-18-8-4-3-5-9-18/h3-14H,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | ZPRXLAHNVHRPMM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|