C20H18N2O2 — CID 108523122
N-(3,4-dimethylphenyl)-N'-naphthalen-1-yloxamide (PubChem CID 108523122) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-N'-naphthalen-1-yloxamide.
| Compound Name | N-(3,4-dimethylphenyl)-N'-naphthalen-1-yloxamide |
|---|---|
| PubChem CID | 108523122 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-(3,4-dimethylphenyl)-N'-naphthalen-1-yloxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)Nc2cccc3ccccc23)cc1C |
| InChI | InChI=1S/C20H18N2O2/c1-13-10-11-16(12-14(13)2)21-19(23)20(24)22-18-9-5-7-15-6-3-4-8-17(15)18/h3-12H,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | AMJXCTCPVMXPJW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|