C28H22N4O2 — CID 23966866
1-naphthalen-1-yl-3-[4-(naphthalen-1-ylcarbamoylamino)phenyl]urea (PubChem CID 23966866) has the molecular formula C28H22N4O2 and a molecular weight of 446.51 g/mol. Its IUPAC name is 1-naphthalen-1-yl-3-[4-(naphthalen-1-ylcarbamoylamino)phenyl]urea.
| Compound Name | 1-naphthalen-1-yl-3-[4-(naphthalen-1-ylcarbamoylamino)phenyl]urea |
|---|---|
| PubChem CID | 23966866 |
| Molecular Formula | C28H22N4O2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 1-naphthalen-1-yl-3-[4-(naphthalen-1-ylcarbamoylamino)phenyl]urea |
| SMILES | O=C(Nc1ccc(NC(=O)Nc2cccc3ccccc23)cc1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C28H22N4O2/c33-27(31-25-13-5-9-19-7-1-3-11-23(19)25)29-21-15-17-22(18-16-21)30-28(34)32-26-14-6-10-20-8-2-4-12-24(20)26/h1-18H,(H2,29,31,33)(H2,30,32,34) |
| InChIKey | JYVCBQUZBFCKID-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |