C31H25N3O2S — CID 19712560
N-naphthalen-1-yl-2-phenyl-2-[4-(phenylcarbamoylamino)phenyl]sulfanylacetamide (PubChem CID 19712560) has the molecular formula C31H25N3O2S and a molecular weight of 503.63 g/mol. Its IUPAC name is N-naphthalen-1-yl-2-phenyl-2-[4-(phenylcarbamoylamino)phenyl]sulfanylacetamide.
| Compound Name | N-naphthalen-1-yl-2-phenyl-2-[4-(phenylcarbamoylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19712560 |
| Molecular Formula | C31H25N3O2S |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | N-naphthalen-1-yl-2-phenyl-2-[4-(phenylcarbamoylamino)phenyl]sulfanylacetamide |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(SC(C(=O)Nc2cccc3ccccc23)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H25N3O2S/c35-30(34-28-17-9-13-22-10-7-8-16-27(22)28)29(23-11-3-1-4-12-23)37-26-20-18-25(19-21-26)33-31(36)32-24-14-5-2-6-15-24/h1-21,29H,(H,34,35)(H2,32,33,36) |
| InChIKey | XZHMPDVKUKSENK-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |