C24H22Cl2N2O2S — CID 23097051
N-[4-[2-(2,3-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]butanamide (PubChem CID 23097051) has the molecular formula C24H22Cl2N2O2S and a molecular weight of 473.43 g/mol. Its IUPAC name is N-[4-[2-(2,3-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]butanamide.
| Compound Name | N-[4-[2-(2,3-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]butanamide |
|---|---|
| PubChem CID | 23097051 |
| Molecular Formula | C24H22Cl2N2O2S |
| Molecular Weight | 473.43 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | N-[4-[2-(2,3-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(SC(C(=O)Nc2cccc(Cl)c2Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22Cl2N2O2S/c1-2-7-21(29)27-17-12-14-18(15-13-17)31-23(16-8-4-3-5-9-16)24(30)28-20-11-6-10-19(25)22(20)26/h3-6,8-15,23H,2,7H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | WTLJDFLCJYHYIF-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.43 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |