C25H24Cl2N2O2S — CID 23098739
N-[4-[2-(3,4-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]pentanamide (PubChem CID 23098739) has the molecular formula C25H24Cl2N2O2S and a molecular weight of 487.45 g/mol. Its IUPAC name is N-[4-[2-(3,4-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]pentanamide.
| Compound Name | N-[4-[2-(3,4-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]pentanamide |
|---|---|
| PubChem CID | 23098739 |
| Molecular Formula | C25H24Cl2N2O2S |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | N-[4-[2-(3,4-dichloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(SC(C(=O)Nc2ccc(Cl)c(Cl)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24Cl2N2O2S/c1-2-3-9-23(30)28-18-10-13-20(14-11-18)32-24(17-7-5-4-6-8-17)25(31)29-19-12-15-21(26)22(27)16-19/h4-8,10-16,24H,2-3,9H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | NITOIUDPGMFUHB-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |