C28H30N2O5S — CID 22786434
4-[4-[2-(4-butoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobutanoic acid (PubChem CID 22786434) has the molecular formula C28H30N2O5S and a molecular weight of 506.62 g/mol. Its IUPAC name is 4-[4-[2-(4-butoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobutanoic acid.
| Compound Name | 4-[4-[2-(4-butoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22786434 |
| Molecular Formula | C28H30N2O5S |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 4-[4-[2-(4-butoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-4-oxobutanoic acid |
| SMILES | CCCCOc1ccc(NC(=O)C(Sc2ccc(NC(=O)CCC(=O)O)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H30N2O5S/c1-2-3-19-35-23-13-9-22(10-14-23)30-28(34)27(20-7-5-4-6-8-20)36-24-15-11-21(12-16-24)29-25(31)17-18-26(32)33/h4-16,27H,2-3,17-19H2,1H3,(H,29,31)(H,30,34)(H,32,33) |
| InChIKey | XNOZVTWKMUYFSF-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|