C28H28N2O4S3 — CID 21169729
N-(4-butoxyphenyl)-2-phenyl-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylacetamide (PubChem CID 21169729) has the molecular formula C28H28N2O4S3 and a molecular weight of 552.74 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-2-phenyl-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylacetamide.
| Compound Name | N-(4-butoxyphenyl)-2-phenyl-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 21169729 |
| Molecular Formula | C28H28N2O4S3 |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | N-(4-butoxyphenyl)-2-phenyl-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylacetamide |
| SMILES | CCCCOc1ccc(NC(=O)C(Sc2ccc(NS(=O)(=O)c3cccs3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28N2O4S3/c1-2-3-19-34-24-15-11-22(12-16-24)29-28(31)27(21-8-5-4-6-9-21)36-25-17-13-23(14-18-25)30-37(32,33)26-10-7-20-35-26/h4-18,20,27,30H,2-3,19H2,1H3,(H,29,31) |
| InChIKey | RLQCUIXERSTYRO-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|