C30H24N2O4S3 — CID 21170659
N-(4-phenoxyphenyl)-2-phenyl-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylacetamide (PubChem CID 21170659) has the molecular formula C30H24N2O4S3 and a molecular weight of 572.73 g/mol. Its IUPAC name is N-(4-phenoxyphenyl)-2-phenyl-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylacetamide.
| Compound Name | N-(4-phenoxyphenyl)-2-phenyl-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 21170659 |
| Molecular Formula | C30H24N2O4S3 |
| Molecular Weight | 572.73 g/mol |
| Exact Mass | 572.09 |
| IUPAC Name | N-(4-phenoxyphenyl)-2-phenyl-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylacetamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)C(Sc1ccc(NS(=O)(=O)c2cccs2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H24N2O4S3/c33-30(31-23-13-17-26(18-14-23)36-25-10-5-2-6-11-25)29(22-8-3-1-4-9-22)38-27-19-15-24(16-20-27)32-39(34,35)28-12-7-21-37-28/h1-21,29,32H,(H,31,33) |
| InChIKey | YGMVLYINEJCWRQ-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.73 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |