C32H26N2O4S2 — CID 21170426
2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(4-phenoxyphenyl)-2-phenylacetamide (PubChem CID 21170426) has the molecular formula C32H26N2O4S2 and a molecular weight of 566.70 g/mol. Its IUPAC name is 2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(4-phenoxyphenyl)-2-phenylacetamide.
| Compound Name | 2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(4-phenoxyphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 21170426 |
| Molecular Formula | C32H26N2O4S2 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | 2-[4-(benzenesulfonamido)phenyl]sulfanyl-N-(4-phenoxyphenyl)-2-phenylacetamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)C(Sc1ccc(NS(=O)(=O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H26N2O4S2/c35-32(33-25-16-20-28(21-17-25)38-27-12-6-2-7-13-27)31(24-10-4-1-5-11-24)39-29-22-18-26(19-23-29)34-40(36,37)30-14-8-3-9-15-30/h1-23,31,34H,(H,33,35) |
| InChIKey | NWKNBPITLDLNBW-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |