C31H26N2O3S2 — CID 21168898
2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanyl-N-naphthalen-2-yl-2-phenylacetamide (PubChem CID 21168898) has the molecular formula C31H26N2O3S2 and a molecular weight of 538.69 g/mol. Its IUPAC name is 2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanyl-N-naphthalen-2-yl-2-phenylacetamide.
| Compound Name | 2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanyl-N-naphthalen-2-yl-2-phenylacetamide |
|---|---|
| PubChem CID | 21168898 |
| Molecular Formula | C31H26N2O3S2 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 2-[4-[(4-methylphenyl)sulfonylamino]phenyl]sulfanyl-N-naphthalen-2-yl-2-phenylacetamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(SC(C(=O)Nc3ccc4ccccc4c3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H26N2O3S2/c1-22-11-19-29(20-12-22)38(35,36)33-26-15-17-28(18-16-26)37-30(24-8-3-2-4-9-24)31(34)32-27-14-13-23-7-5-6-10-25(23)21-27/h2-21,30,33H,1H3,(H,32,34) |
| InChIKey | NARXIGQCWVUVEK-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |