C26H27ClN2O3S — CID 23098239
N-[4-[2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]pentanamide (PubChem CID 23098239) has the molecular formula C26H27ClN2O3S and a molecular weight of 483.03 g/mol. Its IUPAC name is N-[4-[2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]pentanamide.
| Compound Name | N-[4-[2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]pentanamide |
|---|---|
| PubChem CID | 23098239 |
| Molecular Formula | C26H27ClN2O3S |
| Molecular Weight | 483.03 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | N-[4-[2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(SC(C(=O)Nc2ccc(OC)c(Cl)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H27ClN2O3S/c1-3-4-10-24(30)28-19-11-14-21(15-12-19)33-25(18-8-6-5-7-9-18)26(31)29-20-13-16-23(32-2)22(27)17-20/h5-9,11-17,25H,3-4,10H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | CPBCSGGKFSJDFR-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.03 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |