C25H25ClN2O2S — CID 18903168
N-[3-[2-(2-chloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]pentanamide (PubChem CID 18903168) has the molecular formula C25H25ClN2O2S and a molecular weight of 453.01 g/mol. Its IUPAC name is N-[3-[2-(2-chloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]pentanamide.
| Compound Name | N-[3-[2-(2-chloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]pentanamide |
|---|---|
| PubChem CID | 18903168 |
| Molecular Formula | C25H25ClN2O2S |
| Molecular Weight | 453.01 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | N-[3-[2-(2-chloroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1cccc(SC(C(=O)Nc2ccccc2Cl)c2ccccc2)c1 |
| InChI | InChI=1S/C25H25ClN2O2S/c1-2-3-16-23(29)27-19-12-9-13-20(17-19)31-24(18-10-5-4-6-11-18)25(30)28-22-15-8-7-14-21(22)26/h4-15,17,24H,2-3,16H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | KWGNMYMMGOKUAP-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.01 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |