C28H30N2O4S — CID 18903193
ethyl 4-[[2-[3-(pentanoylamino)phenyl]sulfanyl-2-phenylacetyl]amino]benzoate (PubChem CID 18903193) has the molecular formula C28H30N2O4S and a molecular weight of 490.63 g/mol. Its IUPAC name is ethyl 4-[[2-[3-(pentanoylamino)phenyl]sulfanyl-2-phenylacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[3-(pentanoylamino)phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 18903193 |
| Molecular Formula | C28H30N2O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | ethyl 4-[[2-[3-(pentanoylamino)phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
| SMILES | CCCCC(=O)Nc1cccc(SC(C(=O)Nc2ccc(C(=O)OCC)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C28H30N2O4S/c1-3-5-14-25(31)29-23-12-9-13-24(19-23)35-26(20-10-7-6-8-11-20)27(32)30-22-17-15-21(16-18-22)28(33)34-4-2/h6-13,15-19,26H,3-5,14H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | RVJHPBMXJYQTAL-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |