C32H38N2O4S2 — CID 18909737
ethyl 2-[[2-[3-(pentanoylamino)phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 18909737) has the molecular formula C32H38N2O4S2 and a molecular weight of 578.80 g/mol. Its IUPAC name is ethyl 2-[[2-[3-(pentanoylamino)phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-(pentanoylamino)phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18909737 |
| Molecular Formula | C32H38N2O4S2 |
| Molecular Weight | 578.80 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | ethyl 2-[[2-[3-(pentanoylamino)phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCCCC(=O)Nc1cccc(SC(C(=O)Nc2sc3c(c2C(=O)OCC)CCCCCC3)c2ccccc2)c1 |
| InChI | InChI=1S/C32H38N2O4S2/c1-3-5-20-27(35)33-23-16-13-17-24(21-23)39-29(22-14-9-8-10-15-22)30(36)34-31-28(32(37)38-4-2)25-18-11-6-7-12-19-26(25)40-31/h8-10,13-17,21,29H,3-7,11-12,18-20H2,1-2H3,(H,33,35)(H,34,36) |
| InChIKey | LLWDKYLIEMHATR-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.80 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |