C35H36N2O6S2 — CID 18909603
ethyl 2-[[2-[3-[(3,4-dimethoxybenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 18909603) has the molecular formula C35H36N2O6S2 and a molecular weight of 644.82 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[(3,4-dimethoxybenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-[(3,4-dimethoxybenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18909603 |
| Molecular Formula | C35H36N2O6S2 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.20 |
| IUPAC Name | ethyl 2-[[2-[3-[(3,4-dimethoxybenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(Sc2cccc(NC(=O)c3ccc(OC)c(OC)c3)c2)c2ccccc2)sc2c1CCCCC2 |
| InChI | InChI=1S/C35H36N2O6S2/c1-4-43-35(40)30-26-16-9-6-10-17-29(26)45-34(30)37-33(39)31(22-12-7-5-8-13-22)44-25-15-11-14-24(21-25)36-32(38)23-18-19-27(41-2)28(20-23)42-3/h5,7-8,11-15,18-21,31H,4,6,9-10,16-17H2,1-3H3,(H,36,38)(H,37,39) |
| InChIKey | MVCCOQIWQDTUGZ-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |