C35H34N2O6S2 — CID 18897665
2-[[3-[2-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18897665) has the molecular formula C35H34N2O6S2 and a molecular weight of 642.80 g/mol. Its IUPAC name is 2-[[3-[2-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[3-[2-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18897665 |
| Molecular Formula | C35H34N2O6S2 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | 2-[[3-[2-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CCOC(=O)c1c(NC(=O)C(Sc2cccc(NC(=O)c3ccccc3C(=O)O)c2)c2ccccc2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C35H34N2O6S2/c1-2-43-35(42)29-27-19-8-3-4-9-20-28(27)45-33(29)37-32(39)30(22-13-6-5-7-14-22)44-24-16-12-15-23(21-24)36-31(38)25-17-10-11-18-26(25)34(40)41/h5-7,10-18,21,30H,2-4,8-9,19-20H2,1H3,(H,36,38)(H,37,39)(H,40,41) |
| InChIKey | ZKPFSZYVWRAUCQ-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |