C30H32N2O6S2 — CID 18897566
2-[[3-[1-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18897566) has the molecular formula C30H32N2O6S2 and a molecular weight of 580.73 g/mol. Its IUPAC name is 2-[[3-[1-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[3-[1-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18897566 |
| Molecular Formula | C30H32N2O6S2 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | 2-[[3-[1-[(3-ethoxycarbonyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl)amino]-1-oxopropan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CCOC(=O)c1c(NC(=O)C(C)Sc2cccc(NC(=O)c3ccccc3C(=O)O)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C30H32N2O6S2/c1-3-38-30(37)25-23-15-6-4-5-7-16-24(23)40-28(25)32-26(33)18(2)39-20-12-10-11-19(17-20)31-27(34)21-13-8-9-14-22(21)29(35)36/h8-14,17-18H,3-7,15-16H2,1-2H3,(H,31,34)(H,32,33)(H,35,36) |
| InChIKey | QOGFIRYBMGLSCW-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |