C42H41N3O5S2 — CID 19052810
ethyl 2-[2-[3-[[(E)-2-benzamido-3-naphthalen-1-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19052810) has the molecular formula C42H41N3O5S2 and a molecular weight of 731.94 g/mol. Its IUPAC name is ethyl 2-[2-[3-[[(E)-2-benzamido-3-naphthalen-1-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[3-[[(E)-2-benzamido-3-naphthalen-1-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19052810 |
| Molecular Formula | C42H41N3O5S2 |
| Molecular Weight | 731.94 g/mol |
| Exact Mass | 731.25 |
| IUPAC Name | ethyl 2-[2-[3-[[(E)-2-benzamido-3-naphthalen-1-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C)Sc2cccc(NC(=O)/C(=C\c3cccc4ccccc34)NC(=O)c3ccccc3)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C42H41N3O5S2/c1-3-50-42(49)37-34-23-9-4-5-10-24-36(34)52-41(37)45-38(46)27(2)51-32-21-14-20-31(26-32)43-40(48)35(44-39(47)29-16-7-6-8-17-29)25-30-19-13-18-28-15-11-12-22-33(28)30/h6-8,11-22,25-27H,3-5,9-10,23-24H2,1-2H3,(H,43,48)(H,44,47)(H,45,46)/b35-25+ |
| InChIKey | FSVNBACLYJQZQG-KVQDIILNSA-N |
| XLogP | 9.27 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.94 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|