C41H39N3O5S2 — CID 19052843
ethyl 2-[[2-[3-[[(E)-2-benzamido-3-naphthalen-1-ylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19052843) has the molecular formula C41H39N3O5S2 and a molecular weight of 717.91 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[[(E)-2-benzamido-3-naphthalen-1-ylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-naphthalen-1-ylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19052843 |
| Molecular Formula | C41H39N3O5S2 |
| Molecular Weight | 717.91 g/mol |
| Exact Mass | 717.23 |
| IUPAC Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-naphthalen-1-ylprop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2cccc(NC(=O)/C(=C\c3cccc4ccccc34)NC(=O)c3ccccc3)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C41H39N3O5S2/c1-2-49-41(48)37-33-22-8-3-4-9-23-35(33)51-40(37)44-36(45)26-50-31-20-13-19-30(25-31)42-39(47)34(43-38(46)28-15-6-5-7-16-28)24-29-18-12-17-27-14-10-11-21-32(27)29/h5-7,10-21,24-25H,2-4,8-9,22-23,26H2,1H3,(H,42,47)(H,43,46)(H,44,45)/b34-24+ |
| InChIKey | NFOVHQZAWWGFFN-JGRMKTMXSA-N |
| XLogP | 8.88 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.91 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|