C38H39N3O6S2 — CID 19051919
ethyl 2-[[2-[3-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19051919) has the molecular formula C38H39N3O6S2 and a molecular weight of 697.88 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19051919 |
| Molecular Formula | C38H39N3O6S2 |
| Molecular Weight | 697.88 g/mol |
| Exact Mass | 697.23 |
| IUPAC Name | ethyl 2-[[2-[3-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2cccc(NC(=O)/C(=C/c3cccc(OC)c3)NC(=O)c3ccccc3)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C38H39N3O6S2/c1-3-47-38(45)34-30-19-9-4-5-10-20-32(30)49-37(34)41-33(42)24-48-29-18-12-16-27(23-29)39-36(44)31(22-25-13-11-17-28(21-25)46-2)40-35(43)26-14-7-6-8-15-26/h6-8,11-18,21-23H,3-5,9-10,19-20,24H2,1-2H3,(H,39,44)(H,40,43)(H,41,42)/b31-22- |
| InChIKey | VPWWSKZRPZFYHN-VAMRJTSQSA-N |
| XLogP | 7.73 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.88 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|