C35H31Cl2N3O5S2 — CID 19050728
methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 19050728) has the molecular formula C35H31Cl2N3O5S2 and a molecular weight of 708.69 g/mol. Its IUPAC name is methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19050728 |
| Molecular Formula | C35H31Cl2N3O5S2 |
| Molecular Weight | 708.69 g/mol |
| Exact Mass | 707.11 |
| IUPAC Name | methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CSc2cccc(NC(=O)/C(=C\c3ccc(Cl)cc3Cl)NC(=O)c3ccccc3)c2)sc2c1CCCCC2 |
| InChI | InChI=1S/C35H31Cl2N3O5S2/c1-45-35(44)31-26-13-6-3-7-14-29(26)47-34(31)40-30(41)20-46-25-12-8-11-24(19-25)38-33(43)28(17-22-15-16-23(36)18-27(22)37)39-32(42)21-9-4-2-5-10-21/h2,4-5,8-12,15-19H,3,6-7,13-14,20H2,1H3,(H,38,43)(H,39,42)(H,40,41)/b28-17+ |
| InChIKey | SVHPUQKZWCCPHM-OGLMXYFKSA-N |
| XLogP | 8.25 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.69 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|