C38H37Cl2N3O5S2 — CID 19050736
methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19050736) has the molecular formula C38H37Cl2N3O5S2 and a molecular weight of 750.77 g/mol. Its IUPAC name is methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19050736 |
| Molecular Formula | C38H37Cl2N3O5S2 |
| Molecular Weight | 750.77 g/mol |
| Exact Mass | 749.16 |
| IUPAC Name | methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CSc2cccc(NC(=O)/C(=C\c3ccc(Cl)cc3Cl)NC(=O)c3ccccc3)c2)sc2c1CCC(C(C)(C)C)C2 |
| InChI | InChI=1S/C38H37Cl2N3O5S2/c1-38(2,3)24-14-16-28-31(18-24)50-36(33(28)37(47)48-4)43-32(44)21-49-27-12-8-11-26(20-27)41-35(46)30(17-23-13-15-25(39)19-29(23)40)42-34(45)22-9-6-5-7-10-22/h5-13,15,17,19-20,24H,14,16,18,21H2,1-4H3,(H,41,46)(H,42,45)(H,43,44)/b30-17+ |
| InChIKey | XOUKUADPEAIYLG-OCSSWDANSA-N |
| XLogP | 9.13 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.77 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|