C38H38N4O7S2 — CID 19322388
methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19322388) has the molecular formula C38H38N4O7S2 and a molecular weight of 726.88 g/mol. Its IUPAC name is methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19322388 |
| Molecular Formula | C38H38N4O7S2 |
| Molecular Weight | 726.88 g/mol |
| Exact Mass | 726.22 |
| IUPAC Name | methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CSc2cccc(NC(=O)/C(=C\c3ccccc3[N+](=O)[O-])NC(=O)c3ccccc3)c2)sc2c1CCC(C(C)(C)C)C2 |
| InChI | InChI=1S/C38H38N4O7S2/c1-38(2,3)25-17-18-28-31(20-25)51-36(33(28)37(46)49-4)41-32(43)22-50-27-15-10-14-26(21-27)39-35(45)29(40-34(44)23-11-6-5-7-12-23)19-24-13-8-9-16-30(24)42(47)48/h5-16,19,21,25H,17-18,20,22H2,1-4H3,(H,39,45)(H,40,44)(H,41,43)/b29-19+ |
| InChIKey | GAQXQXRGHYTOIJ-VUTHCHCSSA-N |
| XLogP | 7.73 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.88 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|