C40H34N4O7S2 — CID 19052976
methyl 2-[[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19052976) has the molecular formula C40H34N4O7S2 and a molecular weight of 746.87 g/mol. Its IUPAC name is methyl 2-[[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19052976 |
| Molecular Formula | C40H34N4O7S2 |
| Molecular Weight | 746.87 g/mol |
| Exact Mass | 746.19 |
| IUPAC Name | methyl 2-[[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CSc2cccc(NC(=O)/C(=C\c3ccc([N+](=O)[O-])cc3)NC(=O)c3ccccc3)c2)sc2c1CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C40H34N4O7S2/c1-51-40(48)36-32-20-17-28(26-9-4-2-5-10-26)22-34(32)53-39(36)43-35(45)24-52-31-14-8-13-29(23-31)41-38(47)33(42-37(46)27-11-6-3-7-12-27)21-25-15-18-30(19-16-25)44(49)50/h2-16,18-19,21,23,28H,17,20,22,24H2,1H3,(H,41,47)(H,42,46)(H,43,45)/b33-21+ |
| InChIKey | YZEKUOFJTWACDZ-QNKGDIEWSA-N |
| XLogP | 7.86 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.87 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|