C41H45N3O7S2 — CID 19051133
ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19051133) has the molecular formula C41H45N3O7S2 and a molecular weight of 755.96 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19051133 |
| Molecular Formula | C41H45N3O7S2 |
| Molecular Weight | 755.96 g/mol |
| Exact Mass | 755.27 |
| IUPAC Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2cccc(NC(=O)/C(=C\c3ccc(OC)cc3OC)NC(=O)c3ccccc3)c2)sc2c1CCC(C(C)(C)C)C2 |
| InChI | InChI=1S/C41H45N3O7S2/c1-7-51-40(48)36-31-19-17-27(41(2,3)4)21-34(31)53-39(36)44-35(45)24-52-30-15-11-14-28(22-30)42-38(47)32(43-37(46)25-12-9-8-10-13-25)20-26-16-18-29(49-5)23-33(26)50-6/h8-16,18,20,22-23,27H,7,17,19,21,24H2,1-6H3,(H,42,47)(H,43,46)(H,44,45)/b32-20+ |
| InChIKey | ZQLHDTZEZQOJNA-UZWMFBFFSA-N |
| XLogP | 8.23 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.96 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|