C39H41N3O8S2 — CID 19054167
ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19054167) has the molecular formula C39H41N3O8S2 and a molecular weight of 743.90 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19054167 |
| Molecular Formula | C39H41N3O8S2 |
| Molecular Weight | 743.90 g/mol |
| Exact Mass | 743.23 |
| IUPAC Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2cccc(NC(=O)/C(=C\c3cc(OC)c(OC)c(OC)c3)NC(=O)c3ccccc3)c2)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C39H41N3O8S2/c1-6-50-39(46)34-28-16-15-23(2)17-32(28)52-38(34)42-33(43)22-51-27-14-10-13-26(21-27)40-37(45)29(41-36(44)25-11-8-7-9-12-25)18-24-19-30(47-3)35(49-5)31(20-24)48-4/h7-14,18-21,23H,6,15-17,22H2,1-5H3,(H,40,45)(H,41,44)(H,42,43)/b29-18+ |
| InChIKey | JATQOLRZNRETAP-RDRPBHBLSA-N |
| XLogP | 7.22 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.90 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|