C43H49N3O7S2 — CID 19051298
ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19051298) has the molecular formula C43H49N3O7S2 and a molecular weight of 784.01 g/mol. Its IUPAC name is ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19051298 |
| Molecular Formula | C43H49N3O7S2 |
| Molecular Weight | 784.01 g/mol |
| Exact Mass | 783.30 |
| IUPAC Name | ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(CC)Sc2cccc(NC(=O)/C(=C\c3cc(OC)ccc3OC)NC(=O)c3ccccc3)c2)sc2c1CCC(C(C)(C)C)C2 |
| InChI | InChI=1S/C43H49N3O7S2/c1-8-35(40(49)46-41-37(42(50)53-9-2)32-20-18-28(43(3,4)5)24-36(32)55-41)54-31-17-13-16-29(25-31)44-39(48)33(45-38(47)26-14-11-10-12-15-26)23-27-22-30(51-6)19-21-34(27)52-7/h10-17,19,21-23,25,28,35H,8-9,18,20,24H2,1-7H3,(H,44,48)(H,45,47)(H,46,49)/b33-23+ |
| InChIKey | NJNQPTYYSRZTOX-GZZLJNBRSA-N |
| XLogP | 9.01 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.01 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|