C44H43N3O7S2 — CID 19051161
methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19051161) has the molecular formula C44H43N3O7S2 and a molecular weight of 789.98 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19051161 |
| Molecular Formula | C44H43N3O7S2 |
| Molecular Weight | 789.98 g/mol |
| Exact Mass | 789.25 |
| IUPAC Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(OC)cc2OC)NC(=O)c2ccccc2)c1)C(=O)Nc1sc2c(c1C(=O)OC)CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C44H43N3O7S2/c1-5-37(42(50)47-43-39(44(51)54-4)34-22-20-29(24-38(34)56-43)27-13-8-6-9-14-27)55-33-18-12-17-31(25-33)45-41(49)35(46-40(48)28-15-10-7-11-16-28)23-30-19-21-32(52-2)26-36(30)53-3/h6-19,21,23,25-26,29,37H,5,20,22,24H2,1-4H3,(H,45,49)(H,46,48)(H,47,50)/b35-23+ |
| InChIKey | SPCOLRGUTIIFJF-QCFMCPCVSA-N |
| XLogP | 8.74 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.98 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|