C42H37Cl2N3O5S2 — CID 19322549
methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19322549) has the molecular formula C42H37Cl2N3O5S2 and a molecular weight of 798.81 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19322549 |
| Molecular Formula | C42H37Cl2N3O5S2 |
| Molecular Weight | 798.81 g/mol |
| Exact Mass | 797.16 |
| IUPAC Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2cccc(Cl)c2Cl)NC(=O)c2ccccc2)c1)C(=O)Nc1sc2c(c1C(=O)OC)CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C42H37Cl2N3O5S2/c1-3-34(40(50)47-41-36(42(51)52-2)31-21-20-27(23-35(31)54-41)25-12-6-4-7-13-25)53-30-18-11-17-29(24-30)45-39(49)33(22-28-16-10-19-32(43)37(28)44)46-38(48)26-14-8-5-9-15-26/h4-19,22,24,27,34H,3,20-21,23H2,1-2H3,(H,45,49)(H,46,48)(H,47,50)/b33-22+ |
| InChIKey | LLLCHHALGYOSIN-STKMKYKTSA-N |
| XLogP | 10.03 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.81 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|