C41H34Cl2N4O3S2 — CID 19050890
N-[(E)-3-[3-[1-[(3-cyano-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(2,6-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19050890) has the molecular formula C41H34Cl2N4O3S2 and a molecular weight of 765.79 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-[(3-cyano-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(2,6-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-[(3-cyano-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(2,6-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19050890 |
| Molecular Formula | C41H34Cl2N4O3S2 |
| Molecular Weight | 765.79 g/mol |
| Exact Mass | 764.14 |
| IUPAC Name | N-[(E)-3-[3-[1-[(3-cyano-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(2,6-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2c(Cl)cccc2Cl)NC(=O)c2ccccc2)c1)C(=O)Nc1sc2c(c1C#N)CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C41H34Cl2N4O3S2/c1-2-36(40(50)47-41-32(24-44)30-20-19-27(21-37(30)52-41)25-11-5-3-6-12-25)51-29-16-9-15-28(22-29)45-39(49)35(23-31-33(42)17-10-18-34(31)43)46-38(48)26-13-7-4-8-14-26/h3-18,22-23,27,36H,2,19-21H2,1H3,(H,45,49)(H,46,48)(H,47,50)/b35-23+ |
| InChIKey | YCHROHGSWLKMLP-QCFMCPCVSA-N |
| XLogP | 10.12 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.79 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|