C35H30Cl2N4O3S2 — CID 19322540
N-[(E)-3-[3-[1-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(2,3-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19322540) has the molecular formula C35H30Cl2N4O3S2 and a molecular weight of 689.69 g/mol. Its IUPAC name is N-[(E)-3-[3-[1-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(2,3-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[1-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(2,3-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19322540 |
| Molecular Formula | C35H30Cl2N4O3S2 |
| Molecular Weight | 689.69 g/mol |
| Exact Mass | 688.11 |
| IUPAC Name | N-[(E)-3-[3-[1-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-1-oxobutan-2-yl]sulfanylanilino]-1-(2,3-dichlorophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2cccc(Cl)c2Cl)NC(=O)c2ccccc2)c1)C(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C35H30Cl2N4O3S2/c1-2-29(34(44)41-35-26(20-38)25-15-6-7-17-30(25)46-35)45-24-14-9-13-23(19-24)39-33(43)28(18-22-12-8-16-27(36)31(22)37)40-32(42)21-10-4-3-5-11-21/h3-5,8-14,16,18-19,29H,2,6-7,15,17H2,1H3,(H,39,43)(H,40,42)(H,41,44)/b28-18+ |
| InChIKey | PSAJSKAZFKQVON-MTDXEUNCSA-N |
| XLogP | 8.72 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.69 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|