C39H39Cl2N3O5S2 — CID 19050896
ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19050896) has the molecular formula C39H39Cl2N3O5S2 and a molecular weight of 764.80 g/mol. Its IUPAC name is ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19050896 |
| Molecular Formula | C39H39Cl2N3O5S2 |
| Molecular Weight | 764.80 g/mol |
| Exact Mass | 763.17 |
| IUPAC Name | ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(CC)Sc2cccc(NC(=O)/C(=C\c3c(Cl)cccc3Cl)NC(=O)c3ccccc3)c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C39H39Cl2N3O5S2/c1-3-32(37(47)44-38-34(39(48)49-4-2)27-18-10-5-6-11-21-33(27)51-38)50-26-17-12-16-25(22-26)42-36(46)31(23-28-29(40)19-13-20-30(28)41)43-35(45)24-14-8-7-9-15-24/h7-9,12-17,19-20,22-23,32H,3-6,10-11,18,21H2,1-2H3,(H,42,46)(H,43,45)(H,44,47)/b31-23+ |
| InChIKey | BOADBRCCUOWGLZ-UQRQXUALSA-N |
| XLogP | 9.81 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.80 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|