C41H35Cl2N3O5S2 — CID 19322591
ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19322591) has the molecular formula C41H35Cl2N3O5S2 and a molecular weight of 784.79 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19322591 |
| Molecular Formula | C41H35Cl2N3O5S2 |
| Molecular Weight | 784.79 g/mol |
| Exact Mass | 783.14 |
| IUPAC Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,3-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(Sc2cccc(NC(=O)/C(=C\c3cccc(Cl)c3Cl)NC(=O)c3ccccc3)c2)c2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C41H35Cl2N3O5S2/c1-2-51-41(50)34-30-20-9-10-22-33(30)53-40(34)46-39(49)36(25-13-5-3-6-14-25)52-29-19-12-18-28(24-29)44-38(48)32(23-27-17-11-21-31(42)35(27)43)45-37(47)26-15-7-4-8-16-26/h3-8,11-19,21,23-24,36H,2,9-10,20,22H2,1H3,(H,44,48)(H,45,47)(H,46,49)/b32-23+ |
| InChIKey | ZOQDAWGONLSLKQ-AWSUPERCSA-N |
| XLogP | 9.99 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.79 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|