C46H47N3O8S2 — CID 19054097
ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19054097) has the molecular formula C46H47N3O8S2 and a molecular weight of 834.03 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19054097 |
| Molecular Formula | C46H47N3O8S2 |
| Molecular Weight | 834.03 g/mol |
| Exact Mass | 833.28 |
| IUPAC Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(Sc2cccc(NC(=O)/C(=C\c3cc(OC)c(OC)cc3OC)NC(=O)c3ccccc3)c2)c2ccccc2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C46H47N3O8S2/c1-5-57-46(53)40-34-23-14-6-7-15-24-39(34)59-45(40)49-44(52)41(29-17-10-8-11-18-29)58-33-22-16-21-32(27-33)47-43(51)35(48-42(50)30-19-12-9-13-20-30)25-31-26-37(55-3)38(56-4)28-36(31)54-2/h8-13,16-22,25-28,41H,5-7,14-15,23-24H2,1-4H3,(H,47,51)(H,48,50)(H,49,52)/b35-25+ |
| InChIKey | NNGJHOXSOPIWJC-KVQDIILNSA-N |
| XLogP | 9.49 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.03 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|