C41H45N3O8S2 — CID 19054063
methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19054063) has the molecular formula C41H45N3O8S2 and a molecular weight of 771.96 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19054063 |
| Molecular Formula | C41H45N3O8S2 |
| Molecular Weight | 771.96 g/mol |
| Exact Mass | 771.26 |
| IUPAC Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2cc(OC)c(OC)cc2OC)NC(=O)c2ccccc2)c1)C(=O)Nc1sc2c(c1C(=O)OC)CCCCCC2 |
| InChI | InChI=1S/C41H45N3O8S2/c1-6-34(39(47)44-40-36(41(48)52-5)29-19-12-7-8-13-20-35(29)54-40)53-28-18-14-17-27(23-28)42-38(46)30(43-37(45)25-15-10-9-11-16-25)21-26-22-32(50-3)33(51-4)24-31(26)49-2/h9-11,14-18,21-24,34H,6-8,12-13,19-20H2,1-5H3,(H,42,46)(H,43,45)(H,44,47)/b30-21+ |
| InChIKey | YNVLYRJKSRKPKQ-MWAVMZGNSA-N |
| XLogP | 8.14 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.96 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|