C39H41N3O7S2 — CID 19051421
methyl 2-[2-[3-[[(E)-2-benzamido-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate (PubChem CID 19051421) has the molecular formula C39H41N3O7S2 and a molecular weight of 727.91 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(E)-2-benzamido-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19051421 |
| Molecular Formula | C39H41N3O7S2 |
| Molecular Weight | 727.91 g/mol |
| Exact Mass | 727.24 |
| IUPAC Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxylate |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(OC)c(OC)c2)NC(=O)c2ccccc2)c1)C(=O)Nc1sc2c(c1C(=O)OC)CCCCC2 |
| InChI | InChI=1S/C39H41N3O7S2/c1-5-32(37(45)42-38-34(39(46)49-4)28-17-10-7-11-18-33(28)51-38)50-27-16-12-15-26(23-27)40-36(44)29(41-35(43)25-13-8-6-9-14-25)21-24-19-20-30(47-2)31(22-24)48-3/h6,8-9,12-16,19-23,32H,5,7,10-11,17-18H2,1-4H3,(H,40,44)(H,41,43)(H,42,45)/b29-21+ |
| InChIKey | JQMAOCORGRFEAY-XHLNEMQHSA-N |
| XLogP | 7.74 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.91 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|