C40H43N3O6S2 — CID 19052215
methyl 2-[2-[3-[[(E)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19052215) has the molecular formula C40H43N3O6S2 and a molecular weight of 725.93 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(E)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19052215 |
| Molecular Formula | C40H43N3O6S2 |
| Molecular Weight | 725.93 g/mol |
| Exact Mass | 725.26 |
| IUPAC Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(4-ethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(CC)C(=O)Nc3sc4c(c3C(=O)OC)CCCCCC4)c2)cc1 |
| InChI | InChI=1S/C40H43N3O6S2/c1-4-33(38(46)43-39-35(40(47)48-3)31-18-11-6-7-12-19-34(31)51-39)50-30-17-13-16-28(25-30)41-37(45)32(42-36(44)27-14-9-8-10-15-27)24-26-20-22-29(23-21-26)49-5-2/h8-10,13-17,20-25,33H,4-7,11-12,18-19H2,1-3H3,(H,41,45)(H,42,44)(H,43,46)/b32-24+ |
| InChIKey | ZGKRPRDTWLIKKU-FEZSWGLMSA-N |
| XLogP | 8.51 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.93 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|